C21H27NO2S — CID 55773459
4-(4-methylphenyl)-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)butanamide (PubChem CID 55773459) has the molecular formula C21H27NO2S and a molecular weight of 357.52 g/mol. Its IUPAC name is 4-(4-methylphenyl)-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)butanamide.
| Compound Name | 4-(4-methylphenyl)-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 55773459 |
| Molecular Formula | C21H27NO2S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 4-(4-methylphenyl)-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)butanamide |
| SMILES | Cc1ccc(CCCC(=O)N(Cc2cccs2)CC2CCCO2)cc1 |
| InChI | InChI=1S/C21H27NO2S/c1-17-9-11-18(12-10-17)5-2-8-21(23)22(15-19-6-3-13-24-19)16-20-7-4-14-25-20/h4,7,9-12,14,19H,2-3,5-6,8,13,15-16H2,1H3 |
| InChIKey | OCLJWXZNSFJPHY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |