C17H25NO4S — CID 95627935
methyl 3-[[(2R)-oxolan-2-yl]methyl-(4-thiophen-2-ylbutanoyl)amino]propanoate (PubChem CID 95627935) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is methyl 3-[[(2R)-oxolan-2-yl]methyl-(4-thiophen-2-ylbutanoyl)amino]propanoate.
| Compound Name | methyl 3-[[(2R)-oxolan-2-yl]methyl-(4-thiophen-2-ylbutanoyl)amino]propanoate |
|---|---|
| PubChem CID | 95627935 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | methyl 3-[[(2R)-oxolan-2-yl]methyl-(4-thiophen-2-ylbutanoyl)amino]propanoate |
| SMILES | COC(=O)CCN(C[C@H]1CCCO1)C(=O)CCCc1cccs1 |
| InChI | InChI=1S/C17H25NO4S/c1-21-17(20)9-10-18(13-14-5-3-11-22-14)16(19)8-2-6-15-7-4-12-23-15/h4,7,12,14H,2-3,5-6,8-11,13H2,1H3/t14-/m1/s1 |
| InChIKey | JWCKWUDVXZEQCF-CQSZACIVSA-N |
| XLogP | 2.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |