C14H20O3S — CID 78790137
oxan-2-ylmethyl 4-thiophen-2-ylbutanoate (PubChem CID 78790137) has the molecular formula C14H20O3S and a molecular weight of 268.38 g/mol. Its IUPAC name is oxan-2-ylmethyl 4-thiophen-2-ylbutanoate.
| Compound Name | oxan-2-ylmethyl 4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 78790137 |
| Molecular Formula | C14H20O3S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | oxan-2-ylmethyl 4-thiophen-2-ylbutanoate |
| SMILES | O=C(CCCc1cccs1)OCC1CCCCO1 |
| InChI | InChI=1S/C14H20O3S/c15-14(8-3-6-13-7-4-10-18-13)17-11-12-5-1-2-9-16-12/h4,7,10,12H,1-3,5-6,8-9,11H2 |
| InChIKey | SAPPTCVCCIOIBM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |