About oxan-2-ylmethyl 3-phenylsulfanylpropanoate
oxan-2-ylmethyl 3-phenylsulfanylpropanoate (PubChem CID 78788879) has the molecular formula C15H20O3S
and a molecular weight of 280.39 g/mol. Its IUPAC name is oxan-2-ylmethyl 3-phenylsulfanylpropanoate.
Molecular Properties
| Compound Name | oxan-2-ylmethyl 3-phenylsulfanylpropanoate |
| PubChem CID | 78788879 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | oxan-2-ylmethyl 3-phenylsulfanylpropanoate |
| SMILES | O=C(CCSc1ccccc1)OCC1CCCCO1 |
| InChI | InChI=1S/C15H20O3S/c16-15(18-12-13-6-4-5-10-17-13)9-11-19-14-7-2-1-3-8-14/h1-3,7-8,13H,4-6,9-12H2 |
| InChIKey | PMNXFFQINLFMEW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze oxan-2-ylmethyl 3-phenylsulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-2-ylmethyl 3-phenylsulfanylpropanoate?
The IUPAC name of oxan-2-ylmethyl 3-phenylsulfanylpropanoate (CID 78788879) is oxan-2-ylmethyl 3-phenylsulfanylpropanoate.
What is the SMILES notation for oxan-2-ylmethyl 3-phenylsulfanylpropanoate?
The canonical SMILES for oxan-2-ylmethyl 3-phenylsulfanylpropanoate is O=C(CCSc1ccccc1)OCC1CCCCO1.
What is the InChIKey of oxan-2-ylmethyl 3-phenylsulfanylpropanoate?
The InChIKey is PMNXFFQINLFMEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3S/c16-15(18-12-13-6-4-5-10-17-13)9-11-19-14-7-2-1-3-8-14/h1-3,7-8,13H,4-6,9-12H2.
What are the key properties of oxan-2-ylmethyl 3-phenylsulfanylpropanoate?
oxan-2-ylmethyl 3-phenylsulfanylpropanoate has a molecular weight of 280.39 g/mol, XLogP of 3.28, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-2-ylmethyl 3-phenylsulfanylpropanoate is sourced from PubChem (CID 78788879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).