C13H17NO3 — CID 61308884
oxolan-2-ylmethyl 2-(2-aminophenyl)acetate (PubChem CID 61308884) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is oxolan-2-ylmethyl 2-(2-aminophenyl)acetate.
| Compound Name | oxolan-2-ylmethyl 2-(2-aminophenyl)acetate |
|---|---|
| PubChem CID | 61308884 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | oxolan-2-ylmethyl 2-(2-aminophenyl)acetate |
| SMILES | Nc1ccccc1CC(=O)OCC1CCCO1 |
| InChI | InChI=1S/C13H17NO3/c14-12-6-2-1-4-10(12)8-13(15)17-9-11-5-3-7-16-11/h1-2,4,6,11H,3,5,7-9,14H2 |
| InChIKey | PZSOHRNBHZCWGJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|