About oxolan-2-ylmethyl 3-aminopyridine-2-carboxylate
oxolan-2-ylmethyl 3-aminopyridine-2-carboxylate (PubChem CID 103993274) has the molecular formula C11H14N2O3
and a molecular weight of 222.24 g/mol. Its IUPAC name is oxolan-2-ylmethyl 3-aminopyridine-2-carboxylate.
Molecular Properties
| Compound Name | oxolan-2-ylmethyl 3-aminopyridine-2-carboxylate |
| PubChem CID | 103993274 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | oxolan-2-ylmethyl 3-aminopyridine-2-carboxylate |
| SMILES | Nc1cccnc1C(=O)OCC1CCCO1 |
| InChI | InChI=1S/C11H14N2O3/c12-9-4-1-5-13-10(9)11(14)16-7-8-3-2-6-15-8/h1,4-5,8H,2-3,6-7,12H2 |
| InChIKey | DPGFQHZRJAKCHE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze oxolan-2-ylmethyl 3-aminopyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-2-ylmethyl 3-aminopyridine-2-carboxylate?
The IUPAC name of oxolan-2-ylmethyl 3-aminopyridine-2-carboxylate (CID 103993274) is oxolan-2-ylmethyl 3-aminopyridine-2-carboxylate.
What is the SMILES notation for oxolan-2-ylmethyl 3-aminopyridine-2-carboxylate?
The canonical SMILES for oxolan-2-ylmethyl 3-aminopyridine-2-carboxylate is Nc1cccnc1C(=O)OCC1CCCO1.
What is the InChIKey of oxolan-2-ylmethyl 3-aminopyridine-2-carboxylate?
The InChIKey is DPGFQHZRJAKCHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O3/c12-9-4-1-5-13-10(9)11(14)16-7-8-3-2-6-15-8/h1,4-5,8H,2-3,6-7,12H2.
What are the key properties of oxolan-2-ylmethyl 3-aminopyridine-2-carboxylate?
oxolan-2-ylmethyl 3-aminopyridine-2-carboxylate has a molecular weight of 222.24 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-2-ylmethyl 3-aminopyridine-2-carboxylate is sourced from PubChem (CID 103993274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).