C10H13N3O3 — CID 60730655
oxolan-2-ylmethyl 3-aminopyrazine-2-carboxylate (PubChem CID 60730655) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is oxolan-2-ylmethyl 3-aminopyrazine-2-carboxylate.
| Compound Name | oxolan-2-ylmethyl 3-aminopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 60730655 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | oxolan-2-ylmethyl 3-aminopyrazine-2-carboxylate |
| SMILES | Nc1nccnc1C(=O)OCC1CCCO1 |
| InChI | InChI=1S/C10H13N3O3/c11-9-8(12-3-4-13-9)10(14)16-6-7-2-1-5-15-7/h3-4,7H,1-2,5-6H2,(H2,11,13) |
| InChIKey | JRCRFWNQMYFDMM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |