C11H11Cl2NO3 — CID 63841492
oxolan-2-ylmethyl 2,6-dichloropyridine-4-carboxylate (PubChem CID 63841492) has the molecular formula C11H11Cl2NO3 and a molecular weight of 276.12 g/mol. Its IUPAC name is oxolan-2-ylmethyl 2,6-dichloropyridine-4-carboxylate.
| Compound Name | oxolan-2-ylmethyl 2,6-dichloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 63841492 |
| Molecular Formula | C11H11Cl2NO3 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | oxolan-2-ylmethyl 2,6-dichloropyridine-4-carboxylate |
| SMILES | O=C(OCC1CCCO1)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2NO3/c12-9-4-7(5-10(13)14-9)11(15)17-6-8-2-1-3-16-8/h4-5,8H,1-3,6H2 |
| InChIKey | YYRIHMMFGHWEKU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|