C13H15Cl2NO2 — CID 60716775
cyclohexylmethyl 2,6-dichloropyridine-4-carboxylate (PubChem CID 60716775) has the molecular formula C13H15Cl2NO2 and a molecular weight of 288.17 g/mol. Its IUPAC name is cyclohexylmethyl 2,6-dichloropyridine-4-carboxylate.
| Compound Name | cyclohexylmethyl 2,6-dichloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 60716775 |
| Molecular Formula | C13H15Cl2NO2 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | cyclohexylmethyl 2,6-dichloropyridine-4-carboxylate |
| SMILES | O=C(OCC1CCCCC1)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2NO2/c14-11-6-10(7-12(15)16-11)13(17)18-8-9-4-2-1-3-5-9/h6-7,9H,1-5,8H2 |
| InChIKey | SHKNHYLHRMXXAD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|