About cyclohexylmethyl 4-(2-aminoethyl)benzoate
cyclohexylmethyl 4-(2-aminoethyl)benzoate (PubChem CID 55068002) has the molecular formula C16H23NO2
and a molecular weight of 261.37 g/mol. Its IUPAC name is cyclohexylmethyl 4-(2-aminoethyl)benzoate.
Molecular Properties
| Compound Name | cyclohexylmethyl 4-(2-aminoethyl)benzoate |
| PubChem CID | 55068002 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | cyclohexylmethyl 4-(2-aminoethyl)benzoate |
| SMILES | NCCc1ccc(C(=O)OCC2CCCCC2)cc1 |
| InChI | InChI=1S/C16H23NO2/c17-11-10-13-6-8-15(9-7-13)16(18)19-12-14-4-2-1-3-5-14/h6-9,14H,1-5,10-12,17H2 |
| InChIKey | WEMZULQHWZPSPT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexylmethyl 4-(2-aminoethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylmethyl 4-(2-aminoethyl)benzoate?
The IUPAC name of cyclohexylmethyl 4-(2-aminoethyl)benzoate (CID 55068002) is cyclohexylmethyl 4-(2-aminoethyl)benzoate.
What is the SMILES notation for cyclohexylmethyl 4-(2-aminoethyl)benzoate?
The canonical SMILES for cyclohexylmethyl 4-(2-aminoethyl)benzoate is NCCc1ccc(C(=O)OCC2CCCCC2)cc1.
What is the InChIKey of cyclohexylmethyl 4-(2-aminoethyl)benzoate?
The InChIKey is WEMZULQHWZPSPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c17-11-10-13-6-8-15(9-7-13)16(18)19-12-14-4-2-1-3-5-14/h6-9,14H,1-5,10-12,17H2.
What are the key properties of cyclohexylmethyl 4-(2-aminoethyl)benzoate?
cyclohexylmethyl 4-(2-aminoethyl)benzoate has a molecular weight of 261.37 g/mol, XLogP of 2.92, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylmethyl 4-(2-aminoethyl)benzoate is sourced from PubChem (CID 55068002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).