About oxan-2-ylmethyl 6-chloropyridine-2-carboxylate
oxan-2-ylmethyl 6-chloropyridine-2-carboxylate (PubChem CID 55219420) has the molecular formula C12H14ClNO3
and a molecular weight of 255.70 g/mol. Its IUPAC name is oxan-2-ylmethyl 6-chloropyridine-2-carboxylate.
Molecular Properties
| Compound Name | oxan-2-ylmethyl 6-chloropyridine-2-carboxylate |
| PubChem CID | 55219420 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | oxan-2-ylmethyl 6-chloropyridine-2-carboxylate |
| SMILES | O=C(OCC1CCCCO1)c1cccc(Cl)n1 |
| InChI | InChI=1S/C12H14ClNO3/c13-11-6-3-5-10(14-11)12(15)17-8-9-4-1-2-7-16-9/h3,5-6,9H,1-2,4,7-8H2 |
| InChIKey | GRHFTWFXJRCIJS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze oxan-2-ylmethyl 6-chloropyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-2-ylmethyl 6-chloropyridine-2-carboxylate?
The IUPAC name of oxan-2-ylmethyl 6-chloropyridine-2-carboxylate (CID 55219420) is oxan-2-ylmethyl 6-chloropyridine-2-carboxylate.
What is the SMILES notation for oxan-2-ylmethyl 6-chloropyridine-2-carboxylate?
The canonical SMILES for oxan-2-ylmethyl 6-chloropyridine-2-carboxylate is O=C(OCC1CCCCO1)c1cccc(Cl)n1.
What is the InChIKey of oxan-2-ylmethyl 6-chloropyridine-2-carboxylate?
The InChIKey is GRHFTWFXJRCIJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClNO3/c13-11-6-3-5-10(14-11)12(15)17-8-9-4-1-2-7-16-9/h3,5-6,9H,1-2,4,7-8H2.
What are the key properties of oxan-2-ylmethyl 6-chloropyridine-2-carboxylate?
oxan-2-ylmethyl 6-chloropyridine-2-carboxylate has a molecular weight of 255.70 g/mol, XLogP of 2.46, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-2-ylmethyl 6-chloropyridine-2-carboxylate is sourced from PubChem (CID 55219420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).