C16H17NO3S — CID 60599251
oxan-2-ylmethyl 2-phenyl-1,3-thiazole-4-carboxylate (PubChem CID 60599251) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is oxan-2-ylmethyl 2-phenyl-1,3-thiazole-4-carboxylate.
| Compound Name | oxan-2-ylmethyl 2-phenyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 60599251 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | oxan-2-ylmethyl 2-phenyl-1,3-thiazole-4-carboxylate |
| SMILES | O=C(OCC1CCCCO1)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H17NO3S/c18-16(20-10-13-8-4-5-9-19-13)14-11-21-15(17-14)12-6-2-1-3-7-12/h1-3,6-7,11,13H,4-5,8-10H2 |
| InChIKey | VZXAZNPRBLDLMD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |