C21H24N2O3S — CID 8542495
[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2-phenyl-1,3-thiazole-4-carboxylate (PubChem CID 8542495) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is [2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2-phenyl-1,3-thiazole-4-carboxylate.
| Compound Name | [2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2-phenyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 8542495 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | [2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2-phenyl-1,3-thiazole-4-carboxylate |
| SMILES | O=C(OCC(=O)N1CCC[C@@H]2CCCC[C@H]21)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H24N2O3S/c24-19(23-12-6-10-15-7-4-5-11-18(15)23)13-26-21(25)17-14-27-20(22-17)16-8-2-1-3-9-16/h1-3,8-9,14-15,18H,4-7,10-13H2/t15-,18+/m0/s1 |
| InChIKey | QWILTBYKLBSIMM-MAUKXSAKSA-N |
| XLogP | 4.15 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |