C23H28N2O3 — CID 8825474
[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2,4-dimethylquinoline-3-carboxylate (PubChem CID 8825474) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is [2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2,4-dimethylquinoline-3-carboxylate.
| Compound Name | [2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2,4-dimethylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 8825474 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | [2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2,4-dimethylquinoline-3-carboxylate |
| SMILES | Cc1nc2ccccc2c(C)c1C(=O)OCC(=O)N1CCC[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C23H28N2O3/c1-15-18-10-4-5-11-19(18)24-16(2)22(15)23(27)28-14-21(26)25-13-7-9-17-8-3-6-12-20(17)25/h4-5,10-11,17,20H,3,6-9,12-14H2,1-2H3/t17-,20+/m0/s1 |
| InChIKey | FYVGEZVZNBAABH-FXAWDEMLSA-N |
| XLogP | 4.19 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |