C22H26N2O4 — CID 8847492
[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate (PubChem CID 8847492) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate.
| Compound Name | [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 8847492 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)OCC(=O)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C22H26N2O4/c1-15-20(21(23-28-15)17-9-3-2-4-10-17)22(26)27-14-19(25)24-13-7-11-16-8-5-6-12-18(16)24/h2-4,9-10,16,18H,5-8,11-14H2,1H3/t16-,18-/m1/s1 |
| InChIKey | LZNYANIWKMKUPN-SJLPKXTDSA-N |
| XLogP | 3.99 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |