C22H25ClN2O4 — CID 9336683
[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 9336683) has the molecular formula C22H25ClN2O4 and a molecular weight of 416.91 g/mol. Its IUPAC name is [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 9336683 |
| Molecular Formula | C22H25ClN2O4 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1onc(-c2ccccc2Cl)c1C(=O)OCC(=O)N1CCC[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C22H25ClN2O4/c1-14-20(21(24-29-14)16-9-3-4-10-17(16)23)22(27)28-13-19(26)25-12-6-8-15-7-2-5-11-18(15)25/h3-4,9-10,15,18H,2,5-8,11-13H2,1H3/t15-,18+/m1/s1 |
| InChIKey | ORKVHXPUTSLADW-QAPCUYQASA-N |
| XLogP | 4.64 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |