C13H12ClNO4 — CID 9114662
methoxymethyl 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 9114662) has the molecular formula C13H12ClNO4 and a molecular weight of 281.70 g/mol. Its IUPAC name is methoxymethyl 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | methoxymethyl 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 9114662 |
| Molecular Formula | C13H12ClNO4 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | methoxymethyl 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | COCOC(=O)c1c(-c2ccccc2Cl)noc1C |
| InChI | InChI=1S/C13H12ClNO4/c1-8-11(13(16)18-7-17-2)12(15-19-8)9-5-3-4-6-10(9)14/h3-6H,7H2,1-2H3 |
| InChIKey | XKOIFLOYLNQOEU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|