C19H14ClNO4 — CID 1016479
phenacyl 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 1016479) has the molecular formula C19H14ClNO4 and a molecular weight of 355.78 g/mol. Its IUPAC name is phenacyl 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | phenacyl 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 1016479 |
| Molecular Formula | C19H14ClNO4 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | phenacyl 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1onc(-c2ccccc2Cl)c1C(=O)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H14ClNO4/c1-12-17(18(21-25-12)14-9-5-6-10-15(14)20)19(23)24-11-16(22)13-7-3-2-4-8-13/h2-10H,11H2,1H3 |
| InChIKey | IZUMSURANMCBGG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |