C22H27N3O3 — CID 8628126
[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2,3-dimethylquinoxaline-6-carboxylate (PubChem CID 8628126) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is [2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2,3-dimethylquinoxaline-6-carboxylate.
| Compound Name | [2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2,3-dimethylquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 8628126 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | [2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2,3-dimethylquinoxaline-6-carboxylate |
| SMILES | Cc1nc2ccc(C(=O)OCC(=O)N3CCC[C@@H]4CCCC[C@H]43)cc2nc1C |
| InChI | InChI=1S/C22H27N3O3/c1-14-15(2)24-19-12-17(9-10-18(19)23-14)22(27)28-13-21(26)25-11-5-7-16-6-3-4-8-20(16)25/h9-10,12,16,20H,3-8,11,13H2,1-2H3/t16-,20+/m0/s1 |
| InChIKey | XHDPOQQYGKSDBA-OXJNMPFZSA-N |
| XLogP | 3.58 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |