C19H22N2O3 — CID 9201893
[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 4-cyanobenzoate (PubChem CID 9201893) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 4-cyanobenzoate.
| Compound Name | [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 9201893 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 4-cyanobenzoate |
| SMILES | N#Cc1ccc(C(=O)OCC(=O)N2CCC[C@H]3CCCC[C@@H]32)cc1 |
| InChI | InChI=1S/C19H22N2O3/c20-12-14-7-9-16(10-8-14)19(23)24-13-18(22)21-11-3-5-15-4-1-2-6-17(15)21/h7-10,15,17H,1-6,11,13H2/t15-,17+/m1/s1 |
| InChIKey | LNUUNLQOBWKXQN-WBVHZDCISA-N |
| XLogP | 2.90 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |