C21H25N3O3S — CID 9137895
[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxylate (PubChem CID 9137895) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxylate.
| Compound Name | [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 9137895 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(-c2ccccn2)sc1C(=O)OCC(=O)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C21H25N3O3S/c1-14-19(28-20(23-14)16-9-4-5-11-22-16)21(26)27-13-18(25)24-12-6-8-15-7-2-3-10-17(15)24/h4-5,9,11,15,17H,2-3,6-8,10,12-13H2,1H3/t15-,17-/m1/s1 |
| InChIKey | ZLBPCBKYPLZRGN-NVXWUHKLSA-N |
| XLogP | 3.85 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |