C22H25FN2O3S — CID 8647496
[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 8647496) has the molecular formula C22H25FN2O3S and a molecular weight of 416.52 g/mol. Its IUPAC name is [2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | [2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 8647496 |
| Molecular Formula | C22H25FN2O3S |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | [2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(-c2ccc(F)cc2)sc1C(=O)OCC(=O)N1CCC[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C22H25FN2O3S/c1-14-20(29-21(24-14)16-8-10-17(23)11-9-16)22(27)28-13-19(26)25-12-4-6-15-5-2-3-7-18(15)25/h8-11,15,18H,2-7,12-13H2,1H3/t15-,18-/m0/s1 |
| InChIKey | AGVMECFFBVJTFX-YJBOKZPZSA-N |
| XLogP | 4.60 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |