C19H22N2O3S — CID 39967473
[2-(cycloheptylamino)-2-oxoethyl] 2-phenyl-1,3-thiazole-4-carboxylate (PubChem CID 39967473) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is [2-(cycloheptylamino)-2-oxoethyl] 2-phenyl-1,3-thiazole-4-carboxylate.
| Compound Name | [2-(cycloheptylamino)-2-oxoethyl] 2-phenyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 39967473 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [2-(cycloheptylamino)-2-oxoethyl] 2-phenyl-1,3-thiazole-4-carboxylate |
| SMILES | O=C(COC(=O)c1csc(-c2ccccc2)n1)NC1CCCCCC1 |
| InChI | InChI=1S/C19H22N2O3S/c22-17(20-15-10-6-1-2-7-11-15)12-24-19(23)16-13-25-18(21-16)14-8-4-3-5-9-14/h3-5,8-9,13,15H,1-2,6-7,10-12H2,(H,20,22) |
| InChIKey | KTOIBORYOFDCQG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |