C23H31N3O6 — CID 2999823
bis[2-(cyclohexylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate (PubChem CID 2999823) has the molecular formula C23H31N3O6 and a molecular weight of 445.52 g/mol. Its IUPAC name is bis[2-(cyclohexylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate.
| Compound Name | bis[2-(cyclohexylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 2999823 |
| Molecular Formula | C23H31N3O6 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | bis[2-(cyclohexylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate |
| SMILES | O=C(COC(=O)c1cccc(C(=O)OCC(=O)NC2CCCCC2)n1)NC1CCCCC1 |
| InChI | InChI=1S/C23H31N3O6/c27-20(24-16-8-3-1-4-9-16)14-31-22(29)18-12-7-13-19(26-18)23(30)32-15-21(28)25-17-10-5-2-6-11-17/h7,12-13,16-17H,1-6,8-11,14-15H2,(H,24,27)(H,25,28) |
| InChIKey | PBYDZFCXKMSOAZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |