C22H21NO3 — CID 2511548
[2-(cyclopentylamino)-2-oxoethyl] anthracene-9-carboxylate (PubChem CID 2511548) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] anthracene-9-carboxylate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 2511548 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] anthracene-9-carboxylate |
| SMILES | O=C(COC(=O)c1c2ccccc2cc2ccccc12)NC1CCCC1 |
| InChI | InChI=1S/C22H21NO3/c24-20(23-17-9-3-4-10-17)14-26-22(25)21-18-11-5-1-7-15(18)13-16-8-2-6-12-19(16)21/h1-2,5-8,11-13,17H,3-4,9-10,14H2,(H,23,24) |
| InChIKey | VQSBQBZYECNIOQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|