C17H21Cl2NO3 — CID 2489093
[2-(cyclooctylamino)-2-oxoethyl] 2,6-dichlorobenzoate (PubChem CID 2489093) has the molecular formula C17H21Cl2NO3 and a molecular weight of 358.27 g/mol. Its IUPAC name is [2-(cyclooctylamino)-2-oxoethyl] 2,6-dichlorobenzoate.
| Compound Name | [2-(cyclooctylamino)-2-oxoethyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 2489093 |
| Molecular Formula | C17H21Cl2NO3 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | [2-(cyclooctylamino)-2-oxoethyl] 2,6-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1c(Cl)cccc1Cl)NC1CCCCCCC1 |
| InChI | InChI=1S/C17H21Cl2NO3/c18-13-9-6-10-14(19)16(13)17(22)23-11-15(21)20-12-7-4-2-1-3-5-8-12/h6,9-10,12H,1-5,7-8,11H2,(H,20,21) |
| InChIKey | WYWTYPMFTHJIJF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |