C16H20Cl2N2O3 — CID 5116287
N-cyclohexyl-2-[2-(2,3-dichloroanilino)-2-oxoethoxy]acetamide (PubChem CID 5116287) has the molecular formula C16H20Cl2N2O3 and a molecular weight of 359.25 g/mol. Its IUPAC name is N-cyclohexyl-2-[2-(2,3-dichloroanilino)-2-oxoethoxy]acetamide.
| Compound Name | N-cyclohexyl-2-[2-(2,3-dichloroanilino)-2-oxoethoxy]acetamide |
|---|---|
| PubChem CID | 5116287 |
| Molecular Formula | C16H20Cl2N2O3 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | N-cyclohexyl-2-[2-(2,3-dichloroanilino)-2-oxoethoxy]acetamide |
| SMILES | O=C(COCC(=O)NC1CCCCC1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H20Cl2N2O3/c17-12-7-4-8-13(16(12)18)20-15(22)10-23-9-14(21)19-11-5-2-1-3-6-11/h4,7-8,11H,1-3,5-6,9-10H2,(H,19,21)(H,20,22) |
| InChIKey | FLNGGYBLCISYEM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |