C19H18Cl2N2O2 — CID 109051954
3-N-cyclopentyl-1-N-(2,3-dichlorophenyl)benzene-1,3-dicarboxamide (PubChem CID 109051954) has the molecular formula C19H18Cl2N2O2 and a molecular weight of 377.27 g/mol. Its IUPAC name is 3-N-cyclopentyl-1-N-(2,3-dichlorophenyl)benzene-1,3-dicarboxamide.
| Compound Name | 3-N-cyclopentyl-1-N-(2,3-dichlorophenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109051954 |
| Molecular Formula | C19H18Cl2N2O2 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 3-N-cyclopentyl-1-N-(2,3-dichlorophenyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)c1cccc(C(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C19H18Cl2N2O2/c20-15-9-4-10-16(17(15)21)23-19(25)13-6-3-5-12(11-13)18(24)22-14-7-1-2-8-14/h3-6,9-11,14H,1-2,7-8H2,(H,22,24)(H,23,25) |
| InChIKey | JNWARXBBXZNIRQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |