C18H19ClN2O3S — CID 9214750
3-[(2-chlorophenyl)sulfamoyl]-N-cyclopentylbenzamide (PubChem CID 9214750) has the molecular formula C18H19ClN2O3S and a molecular weight of 378.88 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)sulfamoyl]-N-cyclopentylbenzamide.
| Compound Name | 3-[(2-chlorophenyl)sulfamoyl]-N-cyclopentylbenzamide |
|---|---|
| PubChem CID | 9214750 |
| Molecular Formula | C18H19ClN2O3S |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 3-[(2-chlorophenyl)sulfamoyl]-N-cyclopentylbenzamide |
| SMILES | O=C(NC1CCCC1)c1cccc(S(=O)(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C18H19ClN2O3S/c19-16-10-3-4-11-17(16)21-25(23,24)15-9-5-6-13(12-15)18(22)20-14-7-1-2-8-14/h3-6,9-12,14,21H,1-2,7-8H2,(H,20,22) |
| InChIKey | YTVHPYBUINNEFM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |