C18H18Cl2N2O3S — CID 9214869
4-chloro-3-[(2-chlorophenyl)sulfamoyl]-N-cyclopentylbenzamide (PubChem CID 9214869) has the molecular formula C18H18Cl2N2O3S and a molecular weight of 413.33 g/mol. Its IUPAC name is 4-chloro-3-[(2-chlorophenyl)sulfamoyl]-N-cyclopentylbenzamide.
| Compound Name | 4-chloro-3-[(2-chlorophenyl)sulfamoyl]-N-cyclopentylbenzamide |
|---|---|
| PubChem CID | 9214869 |
| Molecular Formula | C18H18Cl2N2O3S |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 4-chloro-3-[(2-chlorophenyl)sulfamoyl]-N-cyclopentylbenzamide |
| SMILES | O=C(NC1CCCC1)c1ccc(Cl)c(S(=O)(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C18H18Cl2N2O3S/c19-14-7-3-4-8-16(14)22-26(24,25)17-11-12(9-10-15(17)20)18(23)21-13-5-1-2-6-13/h3-4,7-11,13,22H,1-2,5-6H2,(H,21,23) |
| InChIKey | PTIYIZLKDSEMKY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |