C18H17F3N2O3S — CID 109063262
N-cyclopentyl-3-[(2,3,4-trifluorophenyl)sulfamoyl]benzamide (PubChem CID 109063262) has the molecular formula C18H17F3N2O3S and a molecular weight of 398.41 g/mol. Its IUPAC name is N-cyclopentyl-3-[(2,3,4-trifluorophenyl)sulfamoyl]benzamide.
| Compound Name | N-cyclopentyl-3-[(2,3,4-trifluorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 109063262 |
| Molecular Formula | C18H17F3N2O3S |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N-cyclopentyl-3-[(2,3,4-trifluorophenyl)sulfamoyl]benzamide |
| SMILES | O=C(NC1CCCC1)c1cccc(S(=O)(=O)Nc2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C18H17F3N2O3S/c19-14-8-9-15(17(21)16(14)20)23-27(25,26)13-7-3-4-11(10-13)18(24)22-12-5-1-2-6-12/h3-4,7-10,12,23H,1-2,5-6H2,(H,22,24) |
| InChIKey | ZQTWAAUKAAQBNP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|