C22H22FN5O3S — CID 55858580
3-[(2-fluorophenyl)sulfamoyl]-N-(1-pyrimidin-2-ylpiperidin-3-yl)benzamide (PubChem CID 55858580) has the molecular formula C22H22FN5O3S and a molecular weight of 455.52 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)sulfamoyl]-N-(1-pyrimidin-2-ylpiperidin-3-yl)benzamide.
| Compound Name | 3-[(2-fluorophenyl)sulfamoyl]-N-(1-pyrimidin-2-ylpiperidin-3-yl)benzamide |
|---|---|
| PubChem CID | 55858580 |
| Molecular Formula | C22H22FN5O3S |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 3-[(2-fluorophenyl)sulfamoyl]-N-(1-pyrimidin-2-ylpiperidin-3-yl)benzamide |
| SMILES | O=C(NC1CCCN(c2ncccn2)C1)c1cccc(S(=O)(=O)Nc2ccccc2F)c1 |
| InChI | InChI=1S/C22H22FN5O3S/c23-19-9-1-2-10-20(19)27-32(30,31)18-8-3-6-16(14-18)21(29)26-17-7-4-13-28(15-17)22-24-11-5-12-25-22/h1-3,5-6,8-12,14,17,27H,4,7,13,15H2,(H,26,29) |
| InChIKey | XQNJARNTPJLKEH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |