C21H19ClN2O4S — CID 30859194
3-[(2-chlorophenyl)sulfamoyl]-N-(2-phenoxyethyl)benzamide (PubChem CID 30859194) has the molecular formula C21H19ClN2O4S and a molecular weight of 430.91 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)sulfamoyl]-N-(2-phenoxyethyl)benzamide.
| Compound Name | 3-[(2-chlorophenyl)sulfamoyl]-N-(2-phenoxyethyl)benzamide |
|---|---|
| PubChem CID | 30859194 |
| Molecular Formula | C21H19ClN2O4S |
| Molecular Weight | 430.91 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 3-[(2-chlorophenyl)sulfamoyl]-N-(2-phenoxyethyl)benzamide |
| SMILES | O=C(NCCOc1ccccc1)c1cccc(S(=O)(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C21H19ClN2O4S/c22-19-11-4-5-12-20(19)24-29(26,27)18-10-6-7-16(15-18)21(25)23-13-14-28-17-8-2-1-3-9-17/h1-12,15,24H,13-14H2,(H,23,25) |
| InChIKey | SJCAKRAZYONTQV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.91 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|