C22H21ClN2O5S — CID 55655492
3-[(2-chlorophenyl)sulfamoyl]-N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]benzamide (PubChem CID 55655492) has the molecular formula C22H21ClN2O5S and a molecular weight of 460.94 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)sulfamoyl]-N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]benzamide.
| Compound Name | 3-[(2-chlorophenyl)sulfamoyl]-N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 55655492 |
| Molecular Formula | C22H21ClN2O5S |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 3-[(2-chlorophenyl)sulfamoyl]-N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]benzamide |
| SMILES | COc1ccc(C(O)CNC(=O)c2cccc(S(=O)(=O)Nc3ccccc3Cl)c2)cc1 |
| InChI | InChI=1S/C22H21ClN2O5S/c1-30-17-11-9-15(10-12-17)21(26)14-24-22(27)16-5-4-6-18(13-16)31(28,29)25-20-8-3-2-7-19(20)23/h2-13,21,25-26H,14H2,1H3,(H,24,27) |
| InChIKey | WLJDMBNFPBYNAN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |