C17H16F3NO3 — CID 110889483
N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-(trifluoromethyl)benzamide (PubChem CID 110889483) has the molecular formula C17H16F3NO3 and a molecular weight of 339.31 g/mol. Its IUPAC name is N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 110889483 |
| Molecular Formula | C17H16F3NO3 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-(trifluoromethyl)benzamide |
| SMILES | COc1ccc(C(O)CNC(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H16F3NO3/c1-24-14-7-5-11(6-8-14)15(22)10-21-16(23)12-3-2-4-13(9-12)17(18,19)20/h2-9,15,22H,10H2,1H3,(H,21,23) |
| InChIKey | NNLUAAUUMPSSMH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |