C18H18F3NO4 — CID 90534721
N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-3,5-dimethoxybenzamide (PubChem CID 90534721) has the molecular formula C18H18F3NO4 and a molecular weight of 369.34 g/mol. Its IUPAC name is N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 90534721 |
| Molecular Formula | C18H18F3NO4 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCC(O)c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C18H18F3NO4/c1-25-14-7-12(8-15(9-14)26-2)17(24)22-10-16(23)11-3-5-13(6-4-11)18(19,20)21/h3-9,16,23H,10H2,1-2H3,(H,22,24) |
| InChIKey | PCJIHNOXFFQMTH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |