C12H11Cl2NO3 — CID 2096945
[2-(cyclopropylamino)-2-oxoethyl] 2,6-dichlorobenzoate (PubChem CID 2096945) has the molecular formula C12H11Cl2NO3 and a molecular weight of 288.13 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 2,6-dichlorobenzoate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 2096945 |
| Molecular Formula | C12H11Cl2NO3 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 2,6-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1c(Cl)cccc1Cl)NC1CC1 |
| InChI | InChI=1S/C12H11Cl2NO3/c13-8-2-1-3-9(14)11(8)12(17)18-6-10(16)15-7-4-5-7/h1-3,7H,4-6H2,(H,15,16) |
| InChIKey | SPAICMOQVLZKJW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |