C12H13ClN2O3 — CID 61236477
[2-(cyclopropylamino)-2-oxoethyl] 4-amino-2-chlorobenzoate (PubChem CID 61236477) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 4-amino-2-chlorobenzoate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 4-amino-2-chlorobenzoate |
|---|---|
| PubChem CID | 61236477 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 4-amino-2-chlorobenzoate |
| SMILES | Nc1ccc(C(=O)OCC(=O)NC2CC2)c(Cl)c1 |
| InChI | InChI=1S/C12H13ClN2O3/c13-10-5-7(14)1-4-9(10)12(17)18-6-11(16)15-8-2-3-8/h1,4-5,8H,2-3,6,14H2,(H,15,16) |
| InChIKey | CFSIWFROKDIPSW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|