C14H17FN2O4 — CID 63099389
[2-(oxan-4-ylamino)-2-oxoethyl] 5-amino-2-fluorobenzoate (PubChem CID 63099389) has the molecular formula C14H17FN2O4 and a molecular weight of 296.30 g/mol. Its IUPAC name is [2-(oxan-4-ylamino)-2-oxoethyl] 5-amino-2-fluorobenzoate.
| Compound Name | [2-(oxan-4-ylamino)-2-oxoethyl] 5-amino-2-fluorobenzoate |
|---|---|
| PubChem CID | 63099389 |
| Molecular Formula | C14H17FN2O4 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | [2-(oxan-4-ylamino)-2-oxoethyl] 5-amino-2-fluorobenzoate |
| SMILES | Nc1ccc(F)c(C(=O)OCC(=O)NC2CCOCC2)c1 |
| InChI | InChI=1S/C14H17FN2O4/c15-12-2-1-9(16)7-11(12)14(19)21-8-13(18)17-10-3-5-20-6-4-10/h1-2,7,10H,3-6,8,16H2,(H,17,18) |
| InChIKey | RQXGPEZNRKVLOF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|