C12H16N2O4S — CID 63099562
[2-(oxan-4-ylamino)-2-oxoethyl] 3-aminothiophene-2-carboxylate (PubChem CID 63099562) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is [2-(oxan-4-ylamino)-2-oxoethyl] 3-aminothiophene-2-carboxylate.
| Compound Name | [2-(oxan-4-ylamino)-2-oxoethyl] 3-aminothiophene-2-carboxylate |
|---|---|
| PubChem CID | 63099562 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | [2-(oxan-4-ylamino)-2-oxoethyl] 3-aminothiophene-2-carboxylate |
| SMILES | Nc1ccsc1C(=O)OCC(=O)NC1CCOCC1 |
| InChI | InChI=1S/C12H16N2O4S/c13-9-3-6-19-11(9)12(16)18-7-10(15)14-8-1-4-17-5-2-8/h3,6,8H,1-2,4-5,7,13H2,(H,14,15) |
| InChIKey | OPTAPTKYGFZKGX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |