C14H20N2O3S — CID 62574037
[2-(cycloheptylamino)-2-oxoethyl] 3-aminothiophene-2-carboxylate (PubChem CID 62574037) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is [2-(cycloheptylamino)-2-oxoethyl] 3-aminothiophene-2-carboxylate.
| Compound Name | [2-(cycloheptylamino)-2-oxoethyl] 3-aminothiophene-2-carboxylate |
|---|---|
| PubChem CID | 62574037 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | [2-(cycloheptylamino)-2-oxoethyl] 3-aminothiophene-2-carboxylate |
| SMILES | Nc1ccsc1C(=O)OCC(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C14H20N2O3S/c15-11-7-8-20-13(11)14(18)19-9-12(17)16-10-5-3-1-2-4-6-10/h7-8,10H,1-6,9,15H2,(H,16,17) |
| InChIKey | TZWGGWBUPWLDNK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |