C8H9N3O4S — CID 61316598
[2-(carbamoylamino)-2-oxoethyl] 3-aminothiophene-2-carboxylate (PubChem CID 61316598) has the molecular formula C8H9N3O4S and a molecular weight of 243.24 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 3-aminothiophene-2-carboxylate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 3-aminothiophene-2-carboxylate |
|---|---|
| PubChem CID | 61316598 |
| Molecular Formula | C8H9N3O4S |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 3-aminothiophene-2-carboxylate |
| SMILES | NC(=O)NC(=O)COC(=O)c1sccc1N |
| InChI | InChI=1S/C8H9N3O4S/c9-4-1-2-16-6(4)7(13)15-3-5(12)11-8(10)14/h1-2H,3,9H2,(H3,10,11,12,14) |
| InChIKey | BBMUKVHPHQTLOD-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |