C10H10N2O5 — CID 7890640
[2-(carbamoylamino)-2-oxoethyl] 2-hydroxybenzoate (PubChem CID 7890640) has the molecular formula C10H10N2O5 and a molecular weight of 238.20 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 2-hydroxybenzoate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 7890640 |
| Molecular Formula | C10H10N2O5 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 2-hydroxybenzoate |
| SMILES | NC(=O)NC(=O)COC(=O)c1ccccc1O |
| InChI | InChI=1S/C10H10N2O5/c11-10(16)12-8(14)5-17-9(15)6-3-1-2-4-7(6)13/h1-4,13H,5H2,(H3,11,12,14,16) |
| InChIKey | OPOOWBSLZBBOBI-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |