C9H11N3O4 — CID 5024305
[2-(carbamoylamino)-2-oxoethyl] 1-methylpyrrole-2-carboxylate (PubChem CID 5024305) has the molecular formula C9H11N3O4 and a molecular weight of 225.20 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 1-methylpyrrole-2-carboxylate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 5024305 |
| Molecular Formula | C9H11N3O4 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 1-methylpyrrole-2-carboxylate |
| SMILES | Cn1cccc1C(=O)OCC(=O)NC(N)=O |
| InChI | InChI=1S/C9H11N3O4/c1-12-4-2-3-6(12)8(14)16-5-7(13)11-9(10)15/h2-4H,5H2,1H3,(H3,10,11,13,15) |
| InChIKey | GOGWDKNJACFZBP-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |