C14H12Cl2N2O3 — CID 2629236
[2-(2,4-dichloroanilino)-2-oxoethyl] 1-methylpyrrole-2-carboxylate (PubChem CID 2629236) has the molecular formula C14H12Cl2N2O3 and a molecular weight of 327.17 g/mol. Its IUPAC name is [2-(2,4-dichloroanilino)-2-oxoethyl] 1-methylpyrrole-2-carboxylate.
| Compound Name | [2-(2,4-dichloroanilino)-2-oxoethyl] 1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 2629236 |
| Molecular Formula | C14H12Cl2N2O3 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | [2-(2,4-dichloroanilino)-2-oxoethyl] 1-methylpyrrole-2-carboxylate |
| SMILES | Cn1cccc1C(=O)OCC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H12Cl2N2O3/c1-18-6-2-3-12(18)14(20)21-8-13(19)17-11-5-4-9(15)7-10(11)16/h2-7H,8H2,1H3,(H,17,19) |
| InChIKey | IXYJSDPSWUGUEH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |