C11H13N3O4 — CID 51616264
[2-(carbamoylamino)-2-oxoethyl] 2-amino-3-methylbenzoate (PubChem CID 51616264) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 2-amino-3-methylbenzoate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 2-amino-3-methylbenzoate |
|---|---|
| PubChem CID | 51616264 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 2-amino-3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCC(=O)NC(N)=O)c1N |
| InChI | InChI=1S/C11H13N3O4/c1-6-3-2-4-7(9(6)12)10(16)18-5-8(15)14-11(13)17/h2-4H,5,12H2,1H3,(H3,13,14,15,17) |
| InChIKey | DONVAYVQXLXQSS-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|