C12H16N4O4 — CID 61322567
[2-(carbamoylamino)-2-oxoethyl] 3-amino-4-(dimethylamino)benzoate (PubChem CID 61322567) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 3-amino-4-(dimethylamino)benzoate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 3-amino-4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 61322567 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 3-amino-4-(dimethylamino)benzoate |
| SMILES | CN(C)c1ccc(C(=O)OCC(=O)NC(N)=O)cc1N |
| InChI | InChI=1S/C12H16N4O4/c1-16(2)9-4-3-7(5-8(9)13)11(18)20-6-10(17)15-12(14)19/h3-5H,6,13H2,1-2H3,(H3,14,15,17,19) |
| InChIKey | KPSQVVNLRDPQBL-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|