About (4-bromophenyl)methyl 3-amino-4-(dimethylamino)benzoate
(4-bromophenyl)methyl 3-amino-4-(dimethylamino)benzoate (PubChem CID 61320857) has the molecular formula C16H17BrN2O2
and a molecular weight of 349.23 g/mol. Its IUPAC name is (4-bromophenyl)methyl 3-amino-4-(dimethylamino)benzoate.
Molecular Properties
| Compound Name | (4-bromophenyl)methyl 3-amino-4-(dimethylamino)benzoate |
| PubChem CID | 61320857 |
| Molecular Formula | C16H17BrN2O2 |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | (4-bromophenyl)methyl 3-amino-4-(dimethylamino)benzoate |
| SMILES | CN(C)c1ccc(C(=O)OCc2ccc(Br)cc2)cc1N |
| InChI | InChI=1S/C16H17BrN2O2/c1-19(2)15-8-5-12(9-14(15)18)16(20)21-10-11-3-6-13(17)7-4-11/h3-9H,10,18H2,1-2H3 |
| InChIKey | UUADTYJBGCOFLH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-bromophenyl)methyl 3-amino-4-(dimethylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl)methyl 3-amino-4-(dimethylamino)benzoate?
The IUPAC name of (4-bromophenyl)methyl 3-amino-4-(dimethylamino)benzoate (CID 61320857) is (4-bromophenyl)methyl 3-amino-4-(dimethylamino)benzoate.
What is the SMILES notation for (4-bromophenyl)methyl 3-amino-4-(dimethylamino)benzoate?
The canonical SMILES for (4-bromophenyl)methyl 3-amino-4-(dimethylamino)benzoate is CN(C)c1ccc(C(=O)OCc2ccc(Br)cc2)cc1N.
What is the InChIKey of (4-bromophenyl)methyl 3-amino-4-(dimethylamino)benzoate?
The InChIKey is UUADTYJBGCOFLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17BrN2O2/c1-19(2)15-8-5-12(9-14(15)18)16(20)21-10-11-3-6-13(17)7-4-11/h3-9H,10,18H2,1-2H3.
What are the key properties of (4-bromophenyl)methyl 3-amino-4-(dimethylamino)benzoate?
(4-bromophenyl)methyl 3-amino-4-(dimethylamino)benzoate has a molecular weight of 349.23 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)methyl 3-amino-4-(dimethylamino)benzoate is sourced from PubChem (CID 61320857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).