C10H10FN3O4 — CID 61322622
[2-(carbamoylamino)-2-oxoethyl] 3-amino-4-fluorobenzoate (PubChem CID 61322622) has the molecular formula C10H10FN3O4 and a molecular weight of 255.20 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 3-amino-4-fluorobenzoate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 3-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 61322622 |
| Molecular Formula | C10H10FN3O4 |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 3-amino-4-fluorobenzoate |
| SMILES | NC(=O)NC(=O)COC(=O)c1ccc(F)c(N)c1 |
| InChI | InChI=1S/C10H10FN3O4/c11-6-2-1-5(3-7(6)12)9(16)18-4-8(15)14-10(13)17/h1-3H,4,12H2,(H3,13,14,15,17) |
| InChIKey | IIENGILYAOMXHN-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|