C9H10FNO5S — CID 129061793
2-(3-amino-4-fluorobenzoyl)oxyethanesulfonic acid (PubChem CID 129061793) has the molecular formula C9H10FNO5S and a molecular weight of 263.25 g/mol. Its IUPAC name is 2-(3-amino-4-fluorobenzoyl)oxyethanesulfonic acid.
| Compound Name | 2-(3-amino-4-fluorobenzoyl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 129061793 |
| Molecular Formula | C9H10FNO5S |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 2-(3-amino-4-fluorobenzoyl)oxyethanesulfonic acid |
| SMILES | Nc1cc(C(=O)OCCS(=O)(=O)O)ccc1F |
| InChI | InChI=1S/C9H10FNO5S/c10-7-2-1-6(5-8(7)11)9(12)16-3-4-17(13,14)15/h1-2,5H,3-4,11H2,(H,13,14,15) |
| InChIKey | SANVCPPZTOECNS-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|